Structure of PDB 6bb2 Chain G Binding Site BS02 |
|
|
Ligand ID | D4J |
InChI | InChI=1S/C26H18ClFN2O3S2/c27-19-4-1-2-5-21(19)35-24-20(31)14-26(30-25(24)32,16-12-13-34-15-16)22-6-3-7-23(29-22)33-18-10-8-17(28)9-11-18/h1-13,15,31H,14H2,(H,30,32)/t26-/m0/s1 |
InChIKey | XFNQOQKMMIFYDK-SANMLTNESA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | c1c(ccc(c1)F)Oc5cccc(C2(CC(=C(C(=O)N2)Sc3c(Cl)cccc3)O)c4cscc4)n5 | OpenEye OEToolkits 2.0.6 | c1ccc(c(c1)SC2=C(CC(NC2=O)(c3ccsc3)c4cccc(n4)Oc5ccc(cc5)F)O)Cl | CACTVS 3.385 | OC1=C(Sc2ccccc2Cl)C(=O)N[C](C1)(c3cscc3)c4cccc(Oc5ccc(F)cc5)n4 | OpenEye OEToolkits 2.0.6 | c1ccc(c(c1)SC2=C(C[C@](NC2=O)(c3ccsc3)c4cccc(n4)Oc5ccc(cc5)F)O)Cl | CACTVS 3.385 | OC1=C(Sc2ccccc2Cl)C(=O)N[C@@](C1)(c3cscc3)c4cccc(Oc5ccc(F)cc5)n4 |
|
Formula | C26 H18 Cl F N2 O3 S2 |
Name | (2S)-5-[(2-chlorophenyl)sulfanyl]-6'-(4-fluorophenoxy)-4-hydroxy-2-(thiophen-3-yl)-2,3-dihydro[2,2'-bipyridin]-6(1H)-one |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 6bb2 Chain G Residue 802
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Catalytic site (original residue number in PDB) |
D165 R168 H192 |
Catalytic site (residue number reindexed from 1) |
D162 R165 H189 |
Enzyme Commision number |
1.1.1.27: L-lactate dehydrogenase. |
|
|
|