Structure of PDB 4r9r Chain G Binding Site BS02 |
|
|
Ligand ID | 3KX |
InChI | InChI=1S/C18H21NO2/c20-16-12-15(11-13-7-3-1-4-8-13)19-18(21)17(16)14-9-5-2-6-10-14/h2,5-6,9-10,12-13H,1,3-4,7-8,11H2,(H2,19,20,21) |
InChIKey | UVVRYOIOMHFQGU-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | c1ccc(cc1)C2=C(C=C(NC2=O)CC3CCCCC3)O | CACTVS 3.385 | OC1=C(C(=O)NC(=C1)CC2CCCCC2)c3ccccc3 | ACDLabs 12.01 | O=C2C(c1ccccc1)=C(O)C=C(N2)CC3CCCCC3 |
|
Formula | C18 H21 N O2 |
Name | 6-(cyclohexylmethyl)-4-hydroxy-3-phenylpyridin-2(1H)-one |
ChEMBL | CHEMBL3742313 |
DrugBank | |
ZINC | ZINC000209498775
|
PDB chain | 4r9r Chain G Residue 302
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
1.3.1.9: enoyl-[acyl-carrier-protein] reductase (NADH). |
|
|
|