Structure of PDB 4f7w Chain G Binding Site BS02 |
|
|
Ligand ID | PN4 |
InChI | InChI=1S/C14H28N2O4/c1-4-5-6-8-15-11(18)7-9-16-13(20)12(19)14(2,3)10-17/h12,17,19H,4-10H2,1-3H3,(H,15,18)(H,16,20)/t12-/m0/s1 |
InChIKey | HWNKKPMQPCHGBA-LBPRGKRZSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.370 | CCCCCNC(=O)CCNC(=O)[C@H](O)C(C)(C)CO | CACTVS 3.370 | CCCCCNC(=O)CCNC(=O)[CH](O)C(C)(C)CO | ACDLabs 12.01 | O=C(NCCC(=O)NCCCCC)C(O)C(C)(C)CO | OpenEye OEToolkits 1.7.6 | CCCCCNC(=O)CCNC(=O)C(C(C)(C)CO)O | OpenEye OEToolkits 1.7.6 | CCCCCNC(=O)CCNC(=O)[C@@H](C(C)(C)CO)O |
|
Formula | C14 H28 N2 O4 |
Name | (2R)-2,4-dihydroxy-3,3-dimethyl-N-[3-oxo-3-(pentylamino)propyl]butanamide; N-Pentylpantothenamide |
ChEMBL | CHEMBL447943 |
DrugBank | |
ZINC | ZINC000006716044
|
PDB chain | 4f7w Chain G Residue 1402
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
2.7.1.33: pantothenate kinase. |
|
|
|