Structure of PDB 8erj Chain F Binding Site BS02 |
|
|
Ligand ID | WQF |
InChI | InChI=1S/C12H17N2O7P/c1-3-10(12(16)17)14-5-9-8(6-21-22(18,19)20)4-13-7(2)11(9)15/h3-4,10,14-15H,1,5-6H2,2H3,(H,16,17)(H2,18,19,20)/t10-/m0/s1 |
InChIKey | HVUNMKYNYWDWQK-JTQLQIEISA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | Cc1ncc(CO[P](O)(O)=O)c(CN[CH](C=C)C(O)=O)c1O | CACTVS 3.385 | Cc1ncc(CO[P](O)(O)=O)c(CN[C@@H](C=C)C(O)=O)c1O | OpenEye OEToolkits 2.0.7 | Cc1c(c(c(cn1)COP(=O)(O)O)CNC(C=C)C(=O)O)O | OpenEye OEToolkits 2.0.7 | Cc1c(c(c(cn1)COP(=O)(O)O)CN[C@@H](C=C)C(=O)O)O | ACDLabs 12.01 | Oc1c(CNC(C=C)C(=O)O)c(cnc1C)COP(=O)(O)O |
|
Formula | C12 H17 N2 O7 P |
Name | (2S)-2-[({3-hydroxy-2-methyl-5-[(phosphonooxy)methyl]pyridin-4-yl}methyl)amino]but-3-enoic acid |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 8erj Chain H Residue 501
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|