Structure of PDB 4btt Chain F Binding Site BS02 |
|
|
Ligand ID | VYR |
InChI | InChI=1S/C28H33ClN4O7S2/c1-3-20-22(33-13-14-39-17-27(33)34)5-4-6-25(20)42(36,37)31-21(28(35)32-11-9-19(38-2)10-12-32)15-18-16-23(40-30-18)24-7-8-26(29)41-24/h4-8,16,19,21,31H,3,9-15,17H2,1-2H3/t21-/m0/s1 |
InChIKey | VOALXMVXTCHJGT-NRFANRHFSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | CCc1c(cccc1[S](=O)(=O)N[C@@H](Cc2cc(on2)c3sc(Cl)cc3)C(=O)N4CC[C@H](CC4)OC)N5CCOCC5=O | OpenEye OEToolkits 1.9.2 | CCc1c(cccc1S(=O)(=O)N[C@@H](Cc2cc(on2)c3ccc(s3)Cl)C(=O)N4CCC(CC4)OC)N5CCOCC5=O | ACDLabs 12.01 | Clc5sc(c1onc(c1)CC(C(=O)N2CCC(OC)CC2)NS(=O)(=O)c4cccc(N3C(=O)COCC3)c4CC)cc5 | OpenEye OEToolkits 1.9.2 | CCc1c(cccc1S(=O)(=O)NC(Cc2cc(on2)c3ccc(s3)Cl)C(=O)N4CCC(CC4)OC)N5CCOCC5=O | CACTVS 3.385 | CCc1c(cccc1[S](=O)(=O)N[CH](Cc2cc(on2)c3sc(Cl)cc3)C(=O)N4CC[CH](CC4)OC)N5CCOCC5=O |
|
Formula | C28 H33 Cl N4 O7 S2 |
Name | N-[(S)-1-[5-(5-Chloro-thiophen-2-yl)-isoxazol-3-ylmethyl]-2-(4-methoxy-piperidin-1-yl)-2-oxo-ethyl]-2-ethyl-3-(3-oxo-morpholin-4-yl)-benzenesulfonamide |
ChEMBL | CHEMBL3091505 |
DrugBank | |
ZINC | ZINC000098209542
|
PDB chain | 4btt Chain F Residue 1246
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Catalytic site (original residue number in PDB) |
G193 S195 G196 |
Catalytic site (residue number reindexed from 1) |
G183 S185 G186 |
Enzyme Commision number |
3.4.21.6: coagulation factor Xa. |
|
|
|