Structure of PDB 2gwc Chain F Binding Site BS02 |
|
|
Ligand ID | BSC |
InChI | InChI=1S/C8H18N2O3S/c1-2-3-5-14(10,13)6-4-7(9)8(11)12/h7,10H,2-6,9H2,1H3,(H,11,12)/t7-,14+/m0/s1 |
InChIKey | KJQFBVYMGADDTQ-JKYUHCHBSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 OpenEye OEToolkits 1.7.6 | CCCCS(=N)(=O)CCC(C(=O)O)N | OpenEye OEToolkits 1.7.6 | CCCCS(=N)(=O)CC[C@@H](C(=O)O)N | CACTVS 3.385 | CCCC[S](=N)(=O)CC[CH](N)C(O)=O | CACTVS 3.385 | CCCC[S@@](=N)(=O)CC[C@H](N)C(O)=O |
|
Formula | C8 H18 N2 O3 S |
Name | (2S)-2-amino-4-(S-butylsulfonimidoyl)butanoic acid; L-BUTHIONINE-[S,R]-SULFOXIMINE |
ChEMBL | |
DrugBank | |
ZINC | ZINC000012405097
|
PDB chain | 2gwc Chain F Residue 2
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
6.3.2.2: glutamate--cysteine ligase. |
|
|
|