Structure of PDB 8fsp Chain E Binding Site BS02 |
|
|
Ligand ID | Y82 |
InChI | InChI=1S/C17H20N4O/c22-17-12-2-1-3-13-16(12)14(19-18-13)6-9-21(17)15-10-20-7-4-11(15)5-8-20/h1-3,11,15H,4-10H2,(H,18,19)/t15-/m1/s1 |
InChIKey | WHLXDRXTKZLGFK-OAHLLOKOSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | O=C1c2cccc3[NH]nc(CCN1C1CN4CCC1CC4)c23 | OpenEye OEToolkits 2.0.7 | c1cc2c3c(c1)[nH]nc3CCN(C2=O)[C@@H]4CN5CCC4CC5 | CACTVS 3.385 | O=C1N(CCc2n[nH]c3cccc1c23)[CH]4CN5CCC4CC5 | CACTVS 3.385 | O=C1N(CCc2n[nH]c3cccc1c23)[C@@H]4CN5CCC4CC5 | OpenEye OEToolkits 2.0.7 | c1cc2c3c(c1)[nH]nc3CCN(C2=O)C4CN5CCC4CC5 |
|
Formula | C17 H20 N4 O |
Name | 5-[(1R,3S,4R)-1-azabicyclo[2.2.2]octan-3-yl]-1,3,4,5-tetrahydro-6H-azepino[5,4,3-cd]indazol-6-one |
ChEMBL | CHEMBL3679408 |
DrugBank | |
ZINC | ZINC000096169941
|
PDB chain | 8fsp Chain E Residue 501
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|