Structure of PDB 4qaa Chain E Binding Site BS02 |
|
|
Ligand ID | KK1 |
InChI | InChI=1S/C19H28N4O/c1-3-4-5-6-7-8-13-21-18-14-17(22-19(20)23-18)15-9-11-16(24-2)12-10-15/h9-12,14H,3-8,13H2,1-2H3,(H3,20,21,22,23) |
InChIKey | HPTZTRACBOHBMX-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | CCCCCCCCNc1cc(nc(N)n1)c2ccc(OC)cc2 | ACDLabs 12.01 | n2c(c1ccc(OC)cc1)cc(nc2N)NCCCCCCCC | OpenEye OEToolkits 1.7.6 | CCCCCCCCNc1cc(nc(n1)N)c2ccc(cc2)OC |
|
Formula | C19 H28 N4 O |
Name | 6-(4-methoxyphenyl)-N~4~-octylpyrimidine-2,4-diamine |
ChEMBL | |
DrugBank | |
ZINC | ZINC000098209079
|
PDB chain | 4qaa Chain E Residue 301
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
Molecular Function |
GO:0004888 |
transmembrane signaling receptor activity |
GO:0005216 |
monoatomic ion channel activity |
GO:0005230 |
extracellular ligand-gated monoatomic ion channel activity |
GO:0005231 |
excitatory extracellular ligand-gated monoatomic ion channel activity |
GO:1904315 |
transmitter-gated monoatomic ion channel activity involved in regulation of postsynaptic membrane potential |
|
|