Structure of PDB 3h1l Chain E Binding Site BS02 |
|
|
Ligand ID | 3H1 |
InChI | InChI=1S/C23H29ClO4/c1-13(10-11-23(5)14(2)7-9-19(26)16(23)4)6-8-17-21(27)18(12-25)15(3)20(24)22(17)28/h6,10-12,14,16,27-28H,7-9H2,1-5H3/b11-10+,13-6+/t14-,16+,23+/m1/s1 |
InChIKey | SETVRSKZJJWOPA-FLDGXQSCSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.341 | C[C@@H]1CCC(=O)[C@H](C)[C@@]1(C)/C=C/C(C)=C/Cc2c(O)c(Cl)c(C)c(C=O)c2O | ACDLabs 10.04 | O=Cc1c(O)c(c(O)c(Cl)c1C)C/C=C(/C=C/C2(C)C(C(=O)CCC2C)C)C | OpenEye OEToolkits 1.5.0 | Cc1c(c(c(c(c1Cl)O)C\C=C(/C)\C=C\[C@]2([C@@H](CCC(=O)[C@@H]2C)C)C)O)C=O | CACTVS 3.341 | C[CH]1CCC(=O)[CH](C)[C]1(C)C=CC(C)=CCc2c(O)c(Cl)c(C)c(C=O)c2O | OpenEye OEToolkits 1.5.0 | Cc1c(c(c(c(c1Cl)O)CC=C(C)C=CC2(C(CCC(=O)C2C)C)C)O)C=O |
|
Formula | C23 H29 Cl O4 |
Name | 3-chloro-4,6-dihydroxy-2-methyl-5-{(2E,4E)-3-methyl-5-[(1R,2R,6R)-1,2,6-trimethyl-3-oxocyclohexyl]penta-2,4-dien-1-yl}benzaldehyde; ASCOCHLORIN |
ChEMBL | CHEMBL132623 |
DrugBank | |
ZINC | ZINC000005431520
|
PDB chain | 3h1l Chain P Residue 3001
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Catalytic site (original residue number in PDB) |
H161 |
Catalytic site (residue number reindexed from 1) |
H161 |
Enzyme Commision number |
7.1.1.8: quinol--cytochrome-c reductase. |
|
|
|