Structure of PDB 8y4b Chain D Binding Site BS02 |
|
|
|
| Ligand ID | A1LXB |
| InChI | InChI=1S/C6H8O5/c1-3-4(7)2-6(10,11-3)5(8)9/h3,10H,2H2,1H3,(H,8,9)/t3-,6-/m0/s1 |
| InChIKey | RVGZVGXMALCWOM-DZSWIPIPSA-N |
| SMILES | | Software | SMILES |
|---|
| OpenEye OEToolkits 2.0.7 | C[C@H]1C(=O)C[C@](O1)(C(=O)O)O | | OpenEye OEToolkits 2.0.7 | CC1C(=O)CC(O1)(C(=O)O)O | | CACTVS 3.385 | C[CH]1O[C](O)(CC1=O)C(O)=O | | CACTVS 3.385 | C[C@@H]1O[C@@](O)(CC1=O)C(O)=O |
|
| Formula | C6 H8 O5 |
| Name | L-2,4-diketo-3-deoxyfuconate;
(2~{S},5~{S})-5-methyl-2-oxidanyl-4-oxidanylidene-oxolane-2-carboxylic acid |
| ChEMBL | |
| DrugBank | |
| ZINC |
|
| PDB chain | 8y4b Chain D Residue 302
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|
