Structure of PDB 8u15 Chain D Binding Site BS02 |
|
|
Ligand ID | 8W7 |
InChI | InChI=1S/C25H27N3O5/c29-23-9-8-21(24(30)26-23)28-15-20-19(25(28)31)2-1-3-22(20)33-16-18-6-4-17(5-7-18)14-27-10-12-32-13-11-27/h1-7,21H,8-16H2,(H,26,29,30)/t21-/m0/s1 |
InChIKey | IXZOHGPZAQLIBH-NRFANRHFSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | c1cc(c2c(c1)C(N(C2)C3C(NC(CC3)=O)=O)=O)OCc5ccc(CN4CCOCC4)cc5 | OpenEye OEToolkits 2.0.6 | c1cc2c(c(c1)OCc3ccc(cc3)CN4CCOCC4)CN(C2=O)C5CCC(=O)NC5=O | CACTVS 3.385 | O=C1CC[CH](N2Cc3c(OCc4ccc(CN5CCOCC5)cc4)cccc3C2=O)C(=O)N1 | OpenEye OEToolkits 2.0.6 | c1cc2c(c(c1)OCc3ccc(cc3)CN4CCOCC4)CN(C2=O)[C@H]5CCC(=O)NC5=O | CACTVS 3.385 | O=C1CC[C@H](N2Cc3c(OCc4ccc(CN5CCOCC5)cc4)cccc3C2=O)C(=O)N1 |
|
Formula | C25 H27 N3 O5 |
Name | (3S)-3-[4-({4-[(morpholin-4-yl)methyl]phenyl}methoxy)-1-oxo-1,3-dihydro-2H-isoindol-2-yl]piperidine-2,6-dione |
ChEMBL | CHEMBL3989927 |
DrugBank | DB12101 |
ZINC | ZINC000118417658
|
PDB chain | 8u15 Chain D Residue 502
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|