Structure of PDB 7ttf Chain D Binding Site BS02 |
|
|
Ligand ID | JV9 |
InChI | InChI=1S/C17H19N5O2/c1-18-17-20-12-5-3-4-11(12)16(21-17)22-9-15(23)19-13-8-10(24-2)6-7-14(13)22/h6-8H,3-5,9H2,1-2H3,(H,19,23)(H,18,20,21) |
InChIKey | BRTSQLXTBUCXNF-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.7 | CNc1nc2c(c(n1)N3CC(=O)Nc4c3ccc(c4)OC)CCC2 | ACDLabs 12.01 | CNc1nc2CCCc2c(n1)N1CC(=O)Nc2cc(ccc21)OC | CACTVS 3.385 | CNc1nc2CCCc2c(n1)N3CC(=O)Nc4cc(OC)ccc34 |
|
Formula | C17 H19 N5 O2 |
Name | 7-methoxy-4-[2-(methylamino)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl]-3,4-dihydroquinoxalin-2(1H)-one |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 7ttf Chain D Residue 502
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|