Structure of PDB 7dm5 Chain D Binding Site BS02 |
|
|
Ligand ID | 4UO |
InChI | InChI=1S/C10H12N4O6/c15-1-3-5(16)6(17)9(20-3)14-2-11-4-7(14)12-10(19)13-8(4)18/h2-3,5-6,9,15-17H,1H2,(H2,12,13,18,19)/t3-,5-,6-,9-/m1/s1 |
InChIKey | UBORTCNDUKBEOP-UUOKFMHZSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.9.2 | c1nc2c(n1C3C(C(C(O3)CO)O)O)NC(=O)NC2=O | ACDLabs 12.01 | O=C1NC(=O)Nc2c1ncn2C3C(C(C(O3)CO)O)O | OpenEye OEToolkits 1.9.2 | c1nc2c(n1[C@H]3[C@@H]([C@@H]([C@H](O3)CO)O)O)NC(=O)NC2=O | CACTVS 3.385 | OC[C@H]1O[C@H]([C@H](O)[C@@H]1O)n2cnc3C(=O)NC(=O)Nc23 | CACTVS 3.385 | OC[CH]1O[CH]([CH](O)[CH]1O)n2cnc3C(=O)NC(=O)Nc23 |
|
Formula | C10 H12 N4 O6 |
Name | 2,3-dihydroxanthosine; Xanthosine |
ChEMBL | CHEMBL402439 |
DrugBank | |
ZINC | ZINC000001561970
|
PDB chain | 7dm5 Chain D Residue 202
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
3.5.4.15: guanosine deaminase. |
|
|
|