Structure of PDB 6u65 Chain D Binding Site BS02 |
|
|
Ligand ID | Q0A |
InChI | InChI=1S/C26H28FN3O4S2/c27-22-8-6-21(7-9-22)19-29-13-15-30(16-14-29)36(33,34)28-25-11-10-23(18-24(25)26(31)32)35-17-12-20-4-2-1-3-5-20/h1-11,18,28H,12-17,19H2,(H,31,32) |
InChIKey | WLQPDKMUGJLFLQ-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | OC(=O)c1cc(SCCc2ccccc2)ccc1N[S](=O)(=O)N3CCN(CC3)Cc4ccc(F)cc4 | OpenEye OEToolkits 2.0.7 | c1ccc(cc1)CCSc2ccc(c(c2)C(=O)O)NS(=O)(=O)N3CCN(CC3)Cc4ccc(cc4)F | ACDLabs 12.01 | c4(c(NS(=O)(N2CCN(Cc1ccc(cc1)F)CC2)=O)ccc(SCCc3ccccc3)c4)C(O)=O |
|
Formula | C26 H28 F N3 O4 S2 |
Name | 2-[({4-[(4-fluorophenyl)methyl]piperazin-1-yl}sulfonyl)amino]-5-[(2-phenylethyl)sulfanyl]benzoic acid |
ChEMBL | CHEMBL4440719 |
DrugBank | |
ZINC |
|
PDB chain | 6u65 Chain D Residue 401
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|