Structure of PDB 6ktk Chain D Binding Site BS02 |
|
|
Ligand ID | 8S0 |
InChI | InChI=1S/C6H10O6/c7-1-2-3(8)4(9)5(10)6(11)12-2/h2-5,7-10H,1H2/t2-,3-,4+,5-/m0/s1 |
InChIKey | PHOQVHQSTUBQQK-KLVWXMOXSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.6 | C([C@H]1[C@@H]([C@H]([C@@H](C(=O)O1)O)O)O)O | CACTVS 3.385 | OC[CH]1OC(=O)[CH](O)[CH](O)[CH]1O | OpenEye OEToolkits 2.0.6 | C(C1C(C(C(C(=O)O1)O)O)O)O | CACTVS 3.385 | OC[C@@H]1OC(=O)[C@@H](O)[C@H](O)[C@H]1O |
|
Formula | C6 H10 O6 |
Name | L-glucono-1,5-lactone; (3~{S},4~{R},5~{R},6~{S})-6-(hydroxymethyl)-3,4,5-tris(oxidanyl)oxan-2-one |
ChEMBL | CHEMBL3039333 |
DrugBank | |
ZINC | ZINC000001532566
|
PDB chain | 6ktk Chain D Residue 403
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|