Structure of PDB 6hnr Chain D Binding Site BS02 |
|
|
Ligand ID | GFE |
InChI | InChI=1S/C11H13Cl2N5/c1-11(2)17-9(14)16-10(15)18(11)6-3-4-7(12)8(13)5-6/h3-5H,1-2H3,(H4,14,15,16,17) |
InChIKey | FPULLBVUFHTKQQ-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.6 | CC1(N=C(N=C(N1c2ccc(c(c2)Cl)Cl)N)N)C | CACTVS 3.385 | CC1(C)N=C(N)N=C(N)N1c2ccc(Cl)c(Cl)c2 |
|
Formula | C11 H13 Cl2 N5 |
Name | 1-(3,4-dichlorophenyl)-6,6-dimethyl-1,3,5-triazine-2,4-diamine |
ChEMBL | CHEMBL92583 |
DrugBank | |
ZINC | ZINC000001666573
|
PDB chain | 6hnr Chain D Residue 302
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|