Structure of PDB 6ahe Chain D Binding Site BS02 |
|
|
Ligand ID | 0WE |
InChI | InChI=1S/C22H23N3O3/c1-14-17-5-3-4-6-18(17)28-19(14)13-25(2)21(27)10-7-15-11-16-8-9-20(26)24-22(16)23-12-15/h3-6,11-12H,7-10,13H2,1-2H3,(H,23,24,26) |
InChIKey | WDNCPCMRTFYNIQ-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | Cc1c2ccccc2oc1CN(C)C(=O)CCc3cc4c(nc3)NC(=O)CC4 | ACDLabs 12.01 | O=C2Nc1ncc(cc1CC2)CCC(=O)N(C)Cc4oc3ccccc3c4C | CACTVS 3.370 | CN(Cc1oc2ccccc2c1C)C(=O)CCc3cnc4NC(=O)CCc4c3 |
|
Formula | C22 H23 N3 O3 |
Name | N-methyl-N-[(3-methyl-1-benzofuran-2-yl)methyl]-3-(7-oxo-5,6,7,8-tetrahydro-1,8-naphthyridin-3-yl)propanamide |
ChEMBL | |
DrugBank | |
ZINC | ZINC000095921071
|
PDB chain | 6ahe Chain D Residue 301
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
1.3.1.9: enoyl-[acyl-carrier-protein] reductase (NADH). |
|
|
|