Structure of PDB 5xke Chain D Binding Site BS02 |
|
|
Ligand ID | LON |
InChI | InChI=1S/C21H25NO5/c1-22-15-8-6-12-10-18(25-3)20(26-4)21(27-5)19(12)13-7-9-17(24-2)16(23)11-14(13)15/h7,9-11,15,22H,6,8H2,1-5H3/t15-/m0/s1 |
InChIKey | NNJPGOLRFBJNIW-HNNXBMFYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.6 | CN[C@H]1CCc2cc(c(c(c2C3=CC=C(C(=O)C=C13)OC)OC)OC)OC | CACTVS 3.385 | CN[CH]1CCc2cc(OC)c(OC)c(OC)c2C3=CC=C(OC)C(=O)C=C13 | CACTVS 3.385 | CN[C@H]1CCc2cc(OC)c(OC)c(OC)c2C3=CC=C(OC)C(=O)C=C13 | OpenEye OEToolkits 2.0.6 | CNC1CCc2cc(c(c(c2C3=CC=C(C(=O)C=C13)OC)OC)OC)OC |
|
Formula | C21 H25 N O5 |
Name | (7S)-1,2,3,10-tetramethoxy-7-(methylamino)-6,7-dihydro-5H-benzo[a]heptalen-9-one |
ChEMBL | CHEMBL312862 |
DrugBank | DB13318 |
ZINC | ZINC000003872132
|
PDB chain | 5xke Chain D Residue 503
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|