Structure of PDB 5xi7 Chain D Binding Site BS02 |
|
|
Ligand ID | PO7 |
InChI | InChI=1S/C19H18F2N4O2/c1-19(2,3)16-13(22-9-23-16)8-15-18(27)24-14(17(26)25-15)7-10-6-11(20)4-5-12(10)21/h4-9H,1-3H3,(H,22,23)(H,24,27)(H,25,26)/b14-7?,15-8- |
InChIKey | YRMXYQDFDXFFPU-QEJIEUBGSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.6 | CC(C)(C)c1c([nH]cn1)/C=C\2/C(=O)NC(=Cc3cc(ccc3F)F)C(=O)N2 | OpenEye OEToolkits 2.0.6 | CC(C)(C)c1c([nH]cn1)C=C2C(=O)NC(=Cc3cc(ccc3F)F)C(=O)N2 | CACTVS 3.385 | CC(C)(C)c1nc[nH]c1C=C2NC(=O)C(NC2=O)=Cc3cc(F)ccc3F | CACTVS 3.385 | CC(C)(C)c1nc[nH]c1\C=C2/NC(=O)\C(NC2=O)=C\c3cc(F)ccc3F |
|
Formula | C19 H18 F2 N4 O2 |
Name | (6Z)-3-[[2,5-bis(fluoranyl)phenyl]methylidene]-6-[(4-tert-butyl-1H-imidazol-5-yl)methylidene]piperazine-2,5-dione |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 5xi7 Chain D Residue 503
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|