Structure of PDB 5wya Chain D Binding Site BS02 |
|
|
Ligand ID | 7VO |
InChI | InChI=1S/C14H23N2O7P/c1-4-8(2)12(14(18)19)16-6-11-10(7-23-24(20,21)22)5-15-9(3)13(11)17/h5,8,12,16-17H,4,6-7H2,1-3H3,(H,18,19)(H2,20,21,22)/t8-,12-/m0/s1 |
InChIKey | GZZDWFDWHXPWJK-UFBFGSQYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.6 | CCC(C)C(C(=O)O)NCc1c(cnc(c1O)C)COP(=O)(O)O | CACTVS 3.385 | CC[C@H](C)[C@H](NCc1c(O)c(C)ncc1CO[P](O)(O)=O)C(O)=O | OpenEye OEToolkits 2.0.6 | CC[C@H](C)[C@@H](C(=O)O)NCc1c(cnc(c1O)C)COP(=O)(O)O | CACTVS 3.385 | CC[CH](C)[CH](NCc1c(O)c(C)ncc1CO[P](O)(O)=O)C(O)=O |
|
Formula | C14 H23 N2 O7 P |
Name | (2S,3S)-3-methyl-2-[[2-methyl-3-oxidanyl-5-(phosphonooxymethyl)pyridin-4-yl]methylamino]pentanoic acid |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 5wya Chain D Residue 1001
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|