Structure of PDB 5sgl Chain D Binding Site BS02 |
|
|
Ligand ID | IXT |
InChI | InChI=1S/C22H23BrN4O4/c1-4-31-21(16-6-8-17(9-7-16)27-11-5-10-25-27)22(28)26-24-14-15-12-18(29-2)20(23)19(13-15)30-3/h5-14,21H,4H2,1-3H3,(H,26,28)/b24-14+/t21-/m0/s1 |
InChIKey | BZLLDUWCQPWMTL-GQBLCDNYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | CCO[CH](C(=O)NN=Cc1cc(OC)c(Br)c(OC)c1)c2ccc(cc2)n3cccn3 | CACTVS 3.385 | CCO[C@H](C(=O)N\N=C\c1cc(OC)c(Br)c(OC)c1)c2ccc(cc2)n3cccn3 | OpenEye OEToolkits 2.0.7 | CCOC(c1ccc(cc1)n2cccn2)C(=O)NN=Cc3cc(c(c(c3)OC)Br)OC | OpenEye OEToolkits 2.0.7 | CCO[C@@H](c1ccc(cc1)n2cccn2)C(=O)N/N=C/c3cc(c(c(c3)OC)Br)OC | ACDLabs 12.01 | COc1cc(cc(OC)c1Br)/C=N/NC(=O)C(OCC)c1ccc(cc1)n1cccn1 |
|
Formula | C22 H23 Br N4 O4 |
Name | (2S)-N'-[(E)-(4-bromo-3,5-dimethoxyphenyl)methylidene]-2-ethoxy-2-[4-(1H-pyrazol-1-yl)phenyl]acetohydrazide |
ChEMBL | |
DrugBank | |
ZINC | ZINC000068198217
|
PDB chain | 5sgl Chain D Residue 803
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
3.1.4.17: 3',5'-cyclic-nucleotide phosphodiesterase. |
|
|
|