Structure of PDB 5msb Chain D Binding Site BS02 |
|
|
Ligand ID | V13 |
InChI | InChI=1S/C8H7F4NO5S2/c9-3-5(11)8(20(13,17)18)6(12)4(10)7(3)19(15,16)2-1-14/h14H,1-2H2,(H2,13,17,18) |
InChIKey | WZGGLNWNBUCLIP-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.370 | N[S](=O)(=O)c1c(F)c(F)c(c(F)c1F)[S](=O)(=O)CCO | ACDLabs 12.01 | Fc1c(F)c(c(F)c(F)c1S(=O)(=O)N)S(=O)(=O)CCO | OpenEye OEToolkits 1.7.6 | C(CS(=O)(=O)c1c(c(c(c(c1F)F)S(=O)(=O)N)F)F)O |
|
Formula | C8 H7 F4 N O5 S2 |
Name | 2,3,5,6-tetrafluoro-4-[(2-hydroxyethyl)sulfonyl]benzenesulfonamide |
ChEMBL | CHEMBL2333417 |
DrugBank | |
ZINC | ZINC000095586323
|
PDB chain | 5msb Chain D Residue 305
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|