Structure of PDB 5lgr Chain D Binding Site BS02 |
|
|
Ligand ID | QVR |
InChI | InChI=1S/C12H15N5O3/c1-2-3-6-8(18)9(19)12(20-6)17-5-16-7-10(13)14-4-15-11(7)17/h2-6,8-9,12,18-19H,1H3,(H2,13,14,15)/b3-2+/t6-,8-,9-,12-/m1/s1 |
InChIKey | UYHMWDPUDJRZGB-JVINVVEESA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.6 | C/C=C/[C@@H]1[C@H]([C@H]([C@@H](O1)n2cnc3c2ncnc3N)O)O | OpenEye OEToolkits 2.0.6 | CC=CC1C(C(C(O1)n2cnc3c2ncnc3N)O)O | CACTVS 3.385 | CC=C[CH]1O[CH]([CH](O)[CH]1O)n2cnc3c(N)ncnc23 | CACTVS 3.385 | C/C=C/[C@H]1O[C@H]([C@H](O)[C@@H]1O)n2cnc3c(N)ncnc23 |
|
Formula | C12 H15 N5 O3 |
Name | (2~{R},3~{R},4~{S},5~{R})-2-(6-aminopurin-9-yl)-5-[(~{E})-prop-1-enyl]oxolane-3,4-diol |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 5lgr Chain H Residue 102
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|