Structure of PDB 4rv8 Chain D Binding Site BS02 |
|
|
Ligand ID | I13 |
InChI | InChI=1S/C20H24ClN5O4/c1-13(25-30-10-9-22)14-5-4-6-15(11-14)20(2,3)24-19(27)23-16-7-8-17(21)18(12-16)26(28)29/h4-8,11-12H,9-10,22H2,1-3H3,(H2,23,24,27)/b25-13+ |
InChIKey | MAIRRISEQUGPIE-DHRITJCHSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | C/C(=N\OCCN)/c1cccc(c1)C(C)(C)NC(=O)Nc2ccc(c(c2)[N+](=O)[O-])Cl | CACTVS 3.385 | CC(=N/OCCN)\c1cccc(c1)C(C)(C)NC(=O)Nc2ccc(Cl)c(c2)[N+]([O-])=O | ACDLabs 12.01 | O=[N+]([O-])c1cc(ccc1Cl)NC(=O)NC(c2cccc(\C(=N\OCCN)C)c2)(C)C | OpenEye OEToolkits 1.7.6 | CC(=NOCCN)c1cccc(c1)C(C)(C)NC(=O)Nc2ccc(c(c2)[N+](=O)[O-])Cl | CACTVS 3.385 | CC(=NOCCN)c1cccc(c1)C(C)(C)NC(=O)Nc2ccc(Cl)c(c2)[N+]([O-])=O |
|
Formula | C20 H24 Cl N5 O4 |
Name | 1-(2-{3-[(1E)-N-(2-aminoethoxy)ethanimidoyl]phenyl}propan-2-yl)-3-(4-chloro-3-nitrophenyl)urea |
ChEMBL | CHEMBL2178623 |
DrugBank | |
ZINC | ZINC000095574545
|
PDB chain | 4rv8 Chain C Residue 503
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
1.1.1.205: IMP dehydrogenase. |
|
|
|