Structure of PDB 4qo8 Chain D Binding Site BS02 |
|
|
Ligand ID | 36U |
InChI | InChI=1S/C18H13Cl3O2S/c19-11-4-1-2-7-16(11)24-18-14(22)8-10(9-15(18)23)17-12(20)5-3-6-13(17)21/h1-7,10,22H,8-9H2/t10-/m0/s1 |
InChIKey | WOBNNXBIQRYYDO-JTQLQIEISA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | c1ccc(c(c1)SC2=C(CC(CC2=O)c3c(cccc3Cl)Cl)O)Cl | OpenEye OEToolkits 1.7.6 | c1ccc(c(c1)SC2=C(C[C@@H](CC2=O)c3c(cccc3Cl)Cl)O)Cl | CACTVS 3.385 | OC1=C(Sc2ccccc2Cl)C(=O)C[C@H](C1)c3c(Cl)cccc3Cl | CACTVS 3.385 | OC1=C(Sc2ccccc2Cl)C(=O)C[CH](C1)c3c(Cl)cccc3Cl | ACDLabs 12.01 | Clc3ccccc3SC2=C(O)CC(c1c(Cl)cccc1Cl)CC2=O |
|
Formula | C18 H13 Cl3 O2 S |
Name | (5S)-2-[(2-chlorophenyl)sulfanyl]-5-(2,6-dichlorophenyl)-3-hydroxycyclohex-2-en-1-one |
ChEMBL | |
DrugBank | |
ZINC | ZINC000103525314
|
PDB chain | 4qo8 Chain D Residue 803
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|