Structure of PDB 4qjw Chain D Binding Site BS02 |
|
|
Ligand ID | WWO |
InChI | InChI=1S/C15H15F3N2O5S2/c16-10-11(17)15(26(22,23)7-6-21)13(12(18)14(10)27(19,24)25)20-8-9-4-2-1-3-5-9/h1-5,20-21H,6-8H2,(H2,19,24,25) |
InChIKey | OLTMJLATLWYQJF-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | N[S](=O)(=O)c1c(F)c(F)c(c(NCc2ccccc2)c1F)[S](=O)(=O)CCO | ACDLabs 12.01 | O=S(=O)(c2c(F)c(F)c(c(F)c2NCc1ccccc1)S(=O)(=O)N)CCO | OpenEye OEToolkits 1.7.6 | c1ccc(cc1)CNc2c(c(c(c(c2S(=O)(=O)CCO)F)F)S(=O)(=O)N)F |
|
Formula | C15 H15 F3 N2 O5 S2 |
Name | 3-(benzylamino)-2,5,6-trifluoro-4-[(2-hydroxyethyl)sulfonyl]benzenesulfonamide |
ChEMBL | CHEMBL4085190 |
DrugBank | |
ZINC | ZINC000208946400
|
PDB chain | 4qjw Chain D Residue 302
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|