Structure of PDB 4n54 Chain D Binding Site BS02 |
|
|
Ligand ID | 2H3 |
InChI | InChI=1S/C6H12O6/c7-1-2(8)4(10)6(12)5(11)3(1)9/h1-12H/t1-,2-,3+,4+,5-,6- |
InChIKey | CDAISMWEOUEBRE-CDRYSYESSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | C1(C(C(C(C(C1O)O)O)O)O)O | ACDLabs 12.01 | OC1C(O)C(O)C(O)C(O)C1O | CACTVS 3.385 | O[CH]1[CH](O)[CH](O)[CH](O)[CH](O)[CH]1O | CACTVS 3.385 | O[C@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O |
|
Formula | C6 H12 O6 |
Name | (1r,2r,3r,4r,5r,6r)-cyclohexane-1,2,3,4,5,6-hexol; scyllo-inositol |
ChEMBL | CHEMBL468154 |
DrugBank | DB03106 |
ZINC | ZINC000100055570
|
PDB chain | 4n54 Chain D Residue 402
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Catalytic site (original residue number in PDB) |
K99 H186 |
Catalytic site (residue number reindexed from 1) |
K96 H183 |
Enzyme Commision number |
1.1.1.- |
|
|
|