Structure of PDB 4jds Chain D Binding Site BS02 |
|
|
Ligand ID | 1L4 |
InChI | InChI=1S/C23H25FN4O3S/c24-21-13-19(12-18-6-7-26-15-20(18)21)32(30,31)27-22(23(29)28-8-1-2-9-28)11-16-4-3-5-17(10-16)14-25/h3-5,10,12-13,22,26-27H,1-2,6-9,11,15H2/t22-/m1/s1 |
InChIKey | HMBXWXQQVHJMOO-JOCHJYFZSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.370 | Fc1cc(cc2CCNCc12)[S](=O)(=O)N[C@H](Cc3cccc(c3)C#N)C(=O)N4CCCC4 | ACDLabs 12.01 | O=C(N1CCCC1)C(NS(=O)(=O)c2cc3c(c(F)c2)CNCC3)Cc4cccc(C#N)c4 | OpenEye OEToolkits 1.7.6 | c1cc(cc(c1)C#N)C[C@H](C(=O)N2CCCC2)NS(=O)(=O)c3cc4c(c(c3)F)CNCC4 | CACTVS 3.370 | Fc1cc(cc2CCNCc12)[S](=O)(=O)N[CH](Cc3cccc(c3)C#N)C(=O)N4CCCC4 | OpenEye OEToolkits 1.7.6 | c1cc(cc(c1)C#N)CC(C(=O)N2CCCC2)NS(=O)(=O)c3cc4c(c(c3)F)CNCC4 |
|
Formula | C23 H25 F N4 O3 S |
Name | N-[(2R)-3-(3-cyanophenyl)-1-oxo-1-(pyrrolidin-1-yl)propan-2-yl]-8-fluoro-1,2,3,4-tetrahydroisoquinoline-6-sulfonamide |
ChEMBL | |
DrugBank | |
ZINC | ZINC000095920698
|
PDB chain | 4jds Chain D Residue 402
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|