Structure of PDB 3n2g Chain D Binding Site BS02 |
|
|
Ligand ID | G2N |
InChI | InChI=1S/C17H19N5O2/c1-3-24-17(23)21-13-9-12-15(16(18)20-13)22-14(10(2)19-12)11-7-5-4-6-8-11/h4-10,19H,3H2,1-2H3,(H3,18,20,21,23)/t10-/m1/s1 |
InChIKey | XXBDOTXPQDVHIP-SNVBAGLBSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.0 | CCOC(=O)Nc1cc2c(c(n1)N)N=C(C(N2)C)c3ccccc3 | OpenEye OEToolkits 1.7.0 | CCOC(=O)Nc1cc2c(c(n1)N)N=C([C@H](N2)C)c3ccccc3 | CACTVS 3.370 | CCOC(=O)Nc1cc2N[C@H](C)C(=Nc2c(N)n1)c3ccccc3 | CACTVS 3.370 | CCOC(=O)Nc1cc2N[CH](C)C(=Nc2c(N)n1)c3ccccc3 | ACDLabs 12.01 | O=C(OCC)Nc2nc(c3N=C(c1ccccc1)C(Nc3c2)C)N |
|
Formula | C17 H19 N5 O2 |
Name | ethyl [(2R)-5-amino-2-methyl-3-phenyl-1,2-dihydropyrido[3,4-b]pyrazin-7-yl]carbamate |
ChEMBL | CHEMBL1232907 |
DrugBank | |
ZINC | ZINC000003787618
|
PDB chain | 3n2g Chain D Residue 700
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|