Structure of PDB 3f7u Chain D Binding Site BS02 |
|
|
Ligand ID | AG4 |
InChI | InChI=1S/C16H19N3O4S2/c1-23-9-5-8-18-15(20)14-10-13(25(17,21)22)11-19-16(14)24-12-6-3-2-4-7-12/h2-4,6-7,10-11H,5,8-9H2,1H3,(H,18,20)(H2,17,21,22) |
InChIKey | YFGZGDDAWQULRR-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | COCCCNC(=O)c1cc(cnc1Sc2ccccc2)[S](N)(=O)=O | OpenEye OEToolkits 1.7.5 | COCCCNC(=O)c1cc(cnc1Sc2ccccc2)S(=O)(=O)N |
|
Formula | C16 H19 N3 O4 S2 |
Name | N-(3-methoxypropyl)-2-(phenylsulfanyl)-5-sulfamoylpyridine-3-carboxamide |
ChEMBL | CHEMBL1099124 |
DrugBank | |
ZINC | ZINC000049114129
|
PDB chain | 3f7u Chain D Residue 268
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|