Structure of PDB 3ey4 Chain D Binding Site BS02 |
|
|
Ligand ID | 352 |
InChI | InChI=1S/C15H19FN2O2S/c1-9(10-5-7-11(16)8-6-10)17-13-18-12(19)15(4,21-13)14(2,3)20/h5-9,20H,1-4H3,(H,17,18,19)/t9-,15+/m0/s1 |
InChIKey | HYVZYASDRIAOPU-BJOHPYRUSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.5.0 | C[C@@H](c1ccc(cc1)F)NC2=NC(=O)[C@](S2)(C)C(C)(C)O | CACTVS 3.341 | C[C@H](NC1=NC(=O)[C@@](C)(S1)C(C)(C)O)c2ccc(F)cc2 | CACTVS 3.341 | C[CH](NC1=NC(=O)[C](C)(S1)C(C)(C)O)c2ccc(F)cc2 | ACDLabs 10.04 | O=C1N=C(SC1(C)C(O)(C)C)NC(c2ccc(F)cc2)C | OpenEye OEToolkits 1.5.0 | CC(c1ccc(cc1)F)NC2=NC(=O)C(S2)(C)C(C)(C)O |
|
Formula | C15 H19 F N2 O2 S |
Name | (5S)-2-{[(1S)-1-(4-fluorophenyl)ethyl]amino}-5-(1-hydroxy-1-methylethyl)-5-methyl-1,3-thiazol-4(5H)-one |
ChEMBL | CHEMBL455907 |
DrugBank | DB07017 |
ZINC | ZINC000039205342
|
PDB chain | 3ey4 Chain D Residue 604
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Catalytic site (original residue number in PDB) |
S170 Y183 K187 |
Catalytic site (residue number reindexed from 1) |
S146 Y159 K163 |
Enzyme Commision number |
1.1.1.146: 11beta-hydroxysteroid dehydrogenase. 1.1.1.201: 7beta-hydroxysteroid dehydrogenase (NADP(+)). |
|
|
|