Structure of PDB 3eck Chain D Binding Site BS02 |
|
|
Ligand ID | XXG |
InChI | InChI=1S/C6H6O6S/c7-5-2-1-4(13(10,11)12)3-6(5,8)9/h1-3,8-9H,(H,10,11,12) |
InChIKey | JGCZOYLBGVHOFP-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.5.0 | C1=CC(=O)C(C=C1S(=O)(=O)O)(O)O | CACTVS 3.341 | OC1(O)C=C(C=CC1=O)[S](O)(=O)=O | ACDLabs 10.04 | O=S(=O)(O)C1=CC(O)(O)C(=O)C=C1 |
|
Formula | C6 H6 O6 S |
Name | 3,3-dihydroxy-4-oxocyclohexa-1,5-diene-1-sulfonic acid; 1,1-dihydroxy-2-keto-5-sulfonyl-cyclohexa-3,5-diene |
ChEMBL | |
DrugBank | |
ZINC | ZINC000058638952
|
PDB chain | 3eck Chain D Residue 502
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|