Structure of PDB 3bgl Chain D Binding Site BS02 |
|
|
Ligand ID | RID |
InChI | InChI=1S/C30H37FN2O7S/c1-20(2)28-30(41(38,39)32-14-16-40-17-15-32)27(21-6-4-3-5-7-21)29(22-8-10-23(31)11-9-22)33(28)13-12-24(34)18-25(35)19-26(36)37/h3-11,20,24-25,34-35H,12-19H2,1-2H3,(H,36,37)/t24-,25-/m1/s1 |
InChIKey | XLVZRBHNHHAPDT-JWQCQUIFSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.341 | CC(C)c1n(CC[C@@H](O)C[C@@H](O)CC(O)=O)c(c2ccc(F)cc2)c(c3ccccc3)c1[S](=O)(=O)N4CCOCC4 | OpenEye OEToolkits 1.5.0 | CC(C)c1c(c(c(n1CC[C@H](C[C@H](CC(=O)O)O)O)c2ccc(cc2)F)c3ccccc3)S(=O)(=O)N4CCOCC4 | ACDLabs 10.04 | O=S(=O)(N1CCOCC1)c4c(c2ccccc2)c(c3ccc(F)cc3)n(c4C(C)C)CCC(O)CC(O)CC(=O)O | OpenEye OEToolkits 1.5.0 | CC(C)c1c(c(c(n1CCC(CC(CC(=O)O)O)O)c2ccc(cc2)F)c3ccccc3)S(=O)(=O)N4CCOCC4 | CACTVS 3.341 | CC(C)c1n(CC[CH](O)C[CH](O)CC(O)=O)c(c2ccc(F)cc2)c(c3ccccc3)c1[S](=O)(=O)N4CCOCC4 |
|
Formula | C30 H37 F N2 O7 S |
Name | (3R,5R)-7-[2-(4-fluorophenyl)-5-(1-methylethyl)-4-(morpholin-4-ylsulfonyl)-3-phenyl-1H-pyrrol-1-yl]-3,5-dihydroxyheptanoic acid |
ChEMBL | CHEMBL1207385 |
DrugBank | |
ZINC | ZINC000024963177
|
PDB chain | 3bgl Chain D Residue 3
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Catalytic site (original residue number in PDB) |
E559 K691 D767 |
Catalytic site (residue number reindexed from 1) |
E110 K242 D318 |
Enzyme Commision number |
1.1.1.34: hydroxymethylglutaryl-CoA reductase (NADPH). |
|
|
|