Structure of PDB 8qud Chain C Binding Site BS02 |
|
|
Ligand ID | WY0 |
InChI | InChI=1S/C20H19N3O4/c1-2-13-18(24)23(19(25)22-13)12-6-7-16(21-10-12)27-15-5-3-4-14-17(15)20(8-9-20)11-26-14/h3-7,10,13H,2,8-9,11H2,1H3,(H,22,25)/t13-/m1/s1 |
InChIKey | XOWFIAMSTPQWIU-CYBMUJFWSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | CC[CH]1NC(=O)N(C1=O)c2ccc(Oc3cccc4OCC5(CC5)c34)nc2 | OpenEye OEToolkits 2.0.7 | CC[C@@H]1C(=O)N(C(=O)N1)c2ccc(nc2)Oc3cccc4c3C5(CC5)CO4 | CACTVS 3.385 | CC[C@H]1NC(=O)N(C1=O)c2ccc(Oc3cccc4OCC5(CC5)c34)nc2 | OpenEye OEToolkits 2.0.7 | CCC1C(=O)N(C(=O)N1)c2ccc(nc2)Oc3cccc4c3C5(CC5)CO4 |
|
Formula | C20 H19 N3 O4 |
Name | (5R)-5-ethyl-3-(6-spiro[2H-1-benzofuran-3,1'-cyclopropane]-4-yloxypyridin-3-yl)imidazolidine-2,4-dione |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 8qud Chain C Residue 602
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|