Structure of PDB 8fwu Chain C Binding Site BS02 |
|
|
Ligand ID | 2J9 |
InChI | InChI=1S/C10H11FN2O2S/c11-7-1-4-9-10(5-7)16(14,15)12-6-13(9)8-2-3-8/h1,4-5,8,12H,2-3,6H2 |
InChIKey | FLTMTBPCYAZIKM-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | Fc1ccc2c(c1)S(=O)(=O)NCN2C3CC3 | CACTVS 3.385 | Fc1ccc2N(CN[S](=O)(=O)c2c1)C3CC3 | OpenEye OEToolkits 1.7.6 | c1cc2c(cc1F)S(=O)(=O)NCN2C3CC3 |
|
Formula | C10 H11 F N2 O2 S |
Name | 4-cyclopropyl-7-fluoro-3,4-dihydro-2H-1,2,4-benzothiadiazine 1,1-dioxide |
ChEMBL | CHEMBL2441067 |
DrugBank | |
ZINC | ZINC000095921421
|
PDB chain | 8fwu Chain B Residue 1005
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|