Structure of PDB 8fdl Chain C Binding Site BS02 |
|
|
Ligand ID | XQU |
InChI | InChI=1S/C11H14Cl2N2O4/c12-10(13)11(18)14-8(5-16)9(17)6-1-3-7(15-19)4-2-6/h1-4,8-10,15-17,19H,5H2,(H,14,18)/t8-,9-/m1/s1 |
InChIKey | BLAGYAGCQKHABH-RKDXNWHRSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.7 | c1cc(ccc1C(C(CO)NC(=O)C(Cl)Cl)O)NO | ACDLabs 12.01 | ONc1ccc(cc1)C(O)C(CO)NC(=O)C(Cl)Cl | OpenEye OEToolkits 2.0.7 | c1cc(ccc1[C@H]([C@@H](CO)NC(=O)C(Cl)Cl)O)NO | CACTVS 3.385 | OC[CH](NC(=O)C(Cl)Cl)[CH](O)c1ccc(NO)cc1 | CACTVS 3.385 | OC[C@@H](NC(=O)C(Cl)Cl)[C@H](O)c1ccc(NO)cc1 |
|
Formula | C11 H14 Cl2 N2 O4 |
Name | nitrosochloramphenicol; 2,2-dichloro-N-{(1R,2R)-1,3-dihydroxy-1-[4-(hydroxyamino)phenyl]propan-2-yl}acetamide |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 8fdl Chain C Residue 205
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|