Structure of PDB 7vnp Chain C Binding Site BS02 |
|
|
Ligand ID | 7YV |
InChI | InChI=1S/C17H23NO/c1-10-6-11(2)16(12(3)7-10)18-17(19)15-9-13-4-5-14(15)8-13/h6-7,13-15H,4-5,8-9H2,1-3H3,(H,18,19)/t13-,14+,15+/m1/s1 |
InChIKey | SIQGKPGBLYKQBB-ILXRZTDVSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.7 | Cc1cc(c(c(c1)C)NC(=O)[C@H]2C[C@@H]3CC[C@H]2C3)C | CACTVS 3.385 | Cc1cc(C)c(NC(=O)[C@H]2C[C@@H]3CC[C@H]2C3)c(C)c1 | OpenEye OEToolkits 2.0.7 | Cc1cc(c(c(c1)C)NC(=O)C2CC3CCC2C3)C | CACTVS 3.385 | Cc1cc(C)c(NC(=O)[CH]2C[CH]3CC[CH]2C3)c(C)c1 |
|
Formula | C17 H23 N O |
Name | (1S,2S,4R)-N-(2,4,6-trimethylphenyl)bicyclo[2.2.1]heptane-2-carboxamid |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 7vnp Chain A Residue 1107
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|