Structure of PDB 6y1z Chain C Binding Site BS02 |
|
|
Ligand ID | O7B |
InChI | InChI=1S/C19H24N2O/c22-19-16-6-2-4-14-3-1-5-15(18(14)16)11-21(19)17-12-20-9-7-13(17)8-10-20/h2,4,6,13,15,17H,1,3,5,7-12H2/t15-,17-/m1/s1 |
InChIKey | CPZBLNMUGSZIPR-NVXWUHKLSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.7 | c1cc2c3c(c1)C(=O)N(C[C@H]3CCC2)[C@@H]4CN5CCC4CC5 | CACTVS 3.385 | O=C1N(C[C@H]2CCCc3cccc1c23)[C@@H]4CN5CCC4CC5 | CACTVS 3.385 | O=C1N(C[CH]2CCCc3cccc1c23)[CH]4CN5CCC4CC5 | OpenEye OEToolkits 2.0.7 | c1cc2c3c(c1)C(=O)N(CC3CCC2)C4CN5CCC4CC5 |
|
Formula | C19 H24 N2 O |
Name | (3~{a}~{S})-2-[(3~{S})-1-azabicyclo[2.2.2]octan-3-yl]-3~{a},4,5,6-tetrahydro-3~{H}-benzo[de]isoquinolin-1-one; Palonosetron; Aloxi |
ChEMBL | CHEMBL1189679 |
DrugBank | DB00377 |
ZINC | ZINC000003795819
|
PDB chain | 6y1z Chain C Residue 501
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|