Structure of PDB 6r1w Chain C Binding Site BS02 |
|
|
Ligand ID | JPW |
InChI | InChI=1S/C13H21N3O4/c14-9-3-1-8(2-4-9)7-20-13(19)15-10-5-6-11(17)16-12(10)18/h8-10H,1-7,14H2,(H,15,19)(H,16,17,18)/t8-,9-,10-/m0/s1 |
InChIKey | HEPIPPZEYDEJHT-GUBZILKMSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | N[CH]1CC[CH](CC1)COC(=O)N[CH]2CCC(=O)NC2=O | OpenEye OEToolkits 2.0.7 | C1CC(CCC1COC(=O)NC2CCC(=O)NC2=O)N | OpenEye OEToolkits 2.0.7 | C1CC(=O)NC(=O)[C@H]1NC(=O)OCC2CCC(CC2)N | CACTVS 3.385 | N[C@H]1CC[C@@H](CC1)COC(=O)N[C@H]2CCC(=O)NC2=O |
|
Formula | C13 H21 N3 O4 |
Name | (4-azanylcyclohexyl)methyl ~{N}-[(3~{S})-2,6-bis(oxidanylidene)piperidin-3-yl]carbamate |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 6r1w Chain C Residue 202
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|