Structure of PDB 6q90 Chain C Binding Site BS02 |
|
|
Ligand ID | HFK |
InChI | InChI=1S/C20H22N4O2/c25-15-9-6-8-14-17(15)20(11-4-1-5-12-20)24-18(21-14)23-19-22-13-7-2-3-10-16(13)26-19/h2-3,7,10H,1,4-6,8-9,11-12H2,(H2,21,22,23,24) |
InChIKey | AZBGHUMVHJKFOO-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.6 | c1ccc2c(c1)nc(o2)NC3=NC4(CCCCC4)C5=C(N3)CCCC5=O | CACTVS 3.385 | O=C1CCCC2=C1C3(CCCCC3)N=C(N2)Nc4oc5ccccc5n4 |
|
Formula | C20 H22 N4 O2 |
Name | 2-(1,3-benzoxazol-2-ylamino)spiro[1,6,7,8-tetrahydroquinazoline-4,1'-cyclohexane]-5-one |
ChEMBL | CHEMBL1325876 |
DrugBank | |
ZINC | ZINC000006492394
|
PDB chain | 6q90 Chain C Residue 402
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
2.7.1.6: galactokinase. |
|
|
|