Structure of PDB 6f4x Chain C Binding Site BS02 |
|
|
Ligand ID | FMC |
InChI | InChI=1S/C10H13N5O4/c11-10-6-4(12-2-13-10)5(14-15-6)9-8(18)7(17)3(1-16)19-9/h2-3,7-9,16-18H,1H2,(H,14,15)(H2,11,12,13)/t3-,7-,8-,9+/m1/s1 |
InChIKey | KBHMEHLJSZMEMI-KSYZLYKTSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.370 | Nc1ncnc2c1[nH]nc2[C@@H]3O[C@H](CO)[C@@H](O)[C@H]3O | CACTVS 3.370 | Nc1ncnc2c1[nH]nc2[CH]3O[CH](CO)[CH](O)[CH]3O | ACDLabs 12.01 | OC1C(OC(CO)C1O)c3nnc2c3ncnc2N | OpenEye OEToolkits 1.7.0 | c1nc2c(c(n1)N)[nH]nc2C3C(C(C(O3)CO)O)O | OpenEye OEToolkits 1.7.0 | c1nc2c(c(n1)N)[nH]nc2[C@H]3[C@@H]([C@@H]([C@H](O3)CO)O)O |
|
Formula | C10 H13 N5 O4 |
Name | (1S)-1-(7-amino-1H-pyrazolo[4,3-d]pyrimidin-3-yl)-1,4-anhydro-D-ribitol |
ChEMBL | CHEMBL471524 |
DrugBank | DB02281 |
ZINC | ZINC000018275505
|
PDB chain | 6f4x Chain C Residue 302
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|