Structure of PDB 6dxs Chain C Binding Site BS02 |
|
|
Ligand ID | HJ7 |
InChI | InChI=1S/C7H6O7/c8-4(7(13)14)1-3(6(11)12)2-5(9)10/h1H,2H2,(H,9,10)(H,11,12)(H,13,14)/b3-1- |
InChIKey | POTZSFVTPSBXLW-IWQZZHSRSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | OC(=O)CC(=CC(=O)C(O)=O)C(O)=O | OpenEye OEToolkits 2.0.6 | C(C(=CC(=O)C(=O)O)C(=O)O)C(=O)O | CACTVS 3.385 | OC(=O)CC(=C/C(=O)C(O)=O)/C(O)=O | OpenEye OEToolkits 2.0.6 | C(/C(=C/C(=O)C(=O)O)/C(=O)O)C(=O)O | ACDLabs 12.01 | C(\C=C(\CC(O)=O)C(O)=O)(=O)C(O)=O |
|
Formula | C7 H6 O7 |
Name | (2Z)-4-oxobut-2-ene-1,2,4-tricarboxylic acid; (3Z)-2-keto-4-carboxy-3-hexenedioate |
ChEMBL | |
DrugBank | |
ZINC | ZINC000001530142
|
PDB chain | 6dxs Chain C Residue 402
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|