Structure of PDB 6bb0 Chain C Binding Site BS02 |
|
|
Ligand ID | D3S |
InChI | InChI=1S/C23H17ClO4S/c24-17-11-5-7-13-20(17)29-21-19(26)14-23(28-22(21)27,15-8-2-1-3-9-15)16-10-4-6-12-18(16)25/h1-13,25-26H,14H2/t23-/m0/s1 |
InChIKey | ARSBHTFMIZULEW-QHCPKHFHSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | OC1=C(Sc2ccccc2Cl)C(=O)O[C](C1)(c3ccccc3)c4ccccc4O | OpenEye OEToolkits 2.0.6 | c1ccc(cc1)C2(CC(=C(C(=O)O2)Sc3ccccc3Cl)O)c4ccccc4O | OpenEye OEToolkits 2.0.6 | c1ccc(cc1)[C@@]2(CC(=C(C(=O)O2)Sc3ccccc3Cl)O)c4ccccc4O | ACDLabs 12.01 | c4ccc(SC=2C(OC(c1ccccc1O)(CC=2O)c3ccccc3)=O)c(c4)Cl | CACTVS 3.385 | OC1=C(Sc2ccccc2Cl)C(=O)O[C@@](C1)(c3ccccc3)c4ccccc4O |
|
Formula | C23 H17 Cl O4 S |
Name | (6S)-3-[(2-chlorophenyl)sulfanyl]-4-hydroxy-6-(2-hydroxyphenyl)-6-phenyl-5,6-dihydro-2H-pyran-2-one |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 6bb0 Chain C Residue 804
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|