Structure of PDB 6bax Chain C Binding Site BS02 |
|
|
Ligand ID | D4S |
InChI | InChI=1S/C21H16ClNO3S2/c22-16-6-1-2-7-18(16)28-19-17(24)11-21(26-20(19)25,14-8-9-27-12-14)13-4-3-5-15(23)10-13/h1-10,12,24H,11,23H2/t21-/m1/s1 |
InChIKey | UHNGEDKMVUGEAD-OAQYLSRUSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | c4ccc(SC=2C(OC(c1cccc(c1)N)(CC=2O)c3cscc3)=O)c(c4)Cl | OpenEye OEToolkits 2.0.6 | c1ccc(c(c1)SC2=C(CC(OC2=O)(c3cccc(c3)N)c4ccsc4)O)Cl | CACTVS 3.385 | Nc1cccc(c1)[C@]2(CC(=C(Sc3ccccc3Cl)C(=O)O2)O)c4cscc4 | OpenEye OEToolkits 2.0.6 | c1ccc(c(c1)SC2=C(C[C@@](OC2=O)(c3cccc(c3)N)c4ccsc4)O)Cl | CACTVS 3.385 | Nc1cccc(c1)[C]2(CC(=C(Sc3ccccc3Cl)C(=O)O2)O)c4cscc4 |
|
Formula | C21 H16 Cl N O3 S2 |
Name | (6R)-6-(3-aminophenyl)-3-[(2-chlorophenyl)sulfanyl]-4-hydroxy-6-(thiophen-3-yl)-5,6-dihydro-2H-pyran-2-one |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 6bax Chain C Residue 803
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|