Structure of PDB 5xag Chain C Binding Site BS02 |
|
|
Ligand ID | 93X |
InChI | InChI=1S/C20H23NO7/c1-25-15-6-5-11(7-14(15)23)18-13(10-22)20(24)21(18)12-8-16(26-2)19(28-4)17(9-12)27-3/h5-9,13,18,22-23H,10H2,1-4H3/t13-,18-/m0/s1 |
InChIKey | JJGIUCCUMYQUIO-UGSOOPFHSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | COc1ccc(cc1O)[CH]2[CH](CO)C(=O)N2c3cc(OC)c(OC)c(OC)c3 | OpenEye OEToolkits 2.0.6 | COc1ccc(cc1O)C2C(C(=O)N2c3cc(c(c(c3)OC)OC)OC)CO | CACTVS 3.385 | COc1ccc(cc1O)[C@H]2[C@H](CO)C(=O)N2c3cc(OC)c(OC)c(OC)c3 | OpenEye OEToolkits 2.0.6 | COc1ccc(cc1O)[C@H]2[C@@H](C(=O)N2c3cc(c(c(c3)OC)OC)OC)CO |
|
Formula | C20 H23 N O7 |
Name | (3~{R},4~{R})-3-(hydroxymethyl)-4-(4-methoxy-3-oxidanyl-phenyl)-1-(3,4,5-trimethoxyphenyl)azetidin-2-one |
ChEMBL | CHEMBL4293724 |
DrugBank | |
ZINC |
|
PDB chain | 5xag Chain D Residue 505
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|