Structure of PDB 5vp1 Chain C Binding Site BS02 |
|
|
Ligand ID | 9GA |
InChI | InChI=1S/C22H22F3N7O3/c1-12-10-31-19(29-18(12)32-11-26-13(2)30-32)16(9-27-31)20(33)28-17(21(3,4)34)14-5-7-15(8-6-14)35-22(23,24)25/h5-11,17,34H,1-4H3,(H,28,33)/t17-/m0/s1 |
InChIKey | HXMZXPQNCNEBPD-KRWDZBQOSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | Cc1ncn(n1)c2nc3n(cc2C)ncc3C(=O)N[C@@H](c4ccc(OC(F)(F)F)cc4)C(C)(C)O | CACTVS 3.385 | Cc1ncn(n1)c2nc3n(cc2C)ncc3C(=O)N[CH](c4ccc(OC(F)(F)F)cc4)C(C)(C)O | OpenEye OEToolkits 2.0.6 | Cc1cn2c(c(cn2)C(=O)NC(c3ccc(cc3)OC(F)(F)F)C(C)(C)O)nc1n4cnc(n4)C | OpenEye OEToolkits 2.0.6 | Cc1cn2c(c(cn2)C(=O)N[C@@H](c3ccc(cc3)OC(F)(F)F)C(C)(C)O)nc1n4cnc(n4)C | ACDLabs 12.01 | n4cn(c1c(C)cn2ncc(c2n1)C(=O)NC(c3ccc(OC(F)(F)F)cc3)C(O)(C)C)nc4C |
|
Formula | C22 H22 F3 N7 O3 |
Name | N-{(1S)-2-hydroxy-2-methyl-1-[4-(trifluoromethoxy)phenyl]propyl}-6-methyl-5-(3-methyl-1H-1,2,4-triazol-1-yl)pyrazolo[1,5-a]pyrimidine-3-carboxamide |
ChEMBL | CHEMBL5268162 |
DrugBank | |
ZINC |
|
PDB chain | 5vp1 Chain C Residue 1003
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
Global view | Local view | Structure summary |
[Spin on]
[Spin off]
[Reset]
[High quality]
[Low quality]
[White background]
[Black background]
|
[Spin on]
[Spin off]
[Reset]
[High quality]
[Low quality]
[White background]
[Black background]
|
PDB | 5vp1 Discovery of a Novel Series of Pyrazolo[1,5-a]pyrimidine-Based Phosphodiesterase 2A Inhibitors Structurally Different from N-((1S)-1-(3-Fluoro-4-(trifluoromethoxy)phenyl)-2-methoxyethyl)-7-methoxy-2-oxo-2,3-dihydropyrido[2,3-b]pyrazine-4(1H)-carboxamide (TAK-915), for the Treatment of Cognitive Disorders. |
Resolution | 1.86 Å |
Binding residue (original residue number in PDB) | L770 H773 T805 D808 L809 I826 Y827 M847 L858 F862 |
Binding residue (residue number reindexed from 1) | L167 H170 T202 D205 L206 I223 Y224 M244 L255 F259 |
Annotation score | 1  |
Binding affinity | MOAD: ic50=0.51nM |
|
|
Enzyme Commision number |
3.1.4.17: 3',5'-cyclic-nucleotide phosphodiesterase. |
|
|
|