Structure of PDB 5q14 Chain C Binding Site BS02 |
|
|
Ligand ID | 9MM |
InChI | InChI=1S/C28H24ClF3N2O3/c29-19-9-6-17(7-10-19)27-33-23-13-20(30)21(31)14-24(23)34(27)25(16-4-2-1-3-5-16)15-37-26-11-8-18(28(35)36)12-22(26)32/h6-14,16,25H,1-5,15H2,(H,35,36)/t25-/m1/s1 |
InChIKey | CPOSGAZIIDJVMJ-RUZDIDTESA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | n3(C(C1CCCCC1)COc2c(F)cc(C(O)=O)cc2)c5cc(F)c(cc5nc3c4ccc(cc4)Cl)F | CACTVS 3.385 | OC(=O)c1ccc(OC[CH](C2CCCCC2)n3c4cc(F)c(F)cc4nc3c5ccc(Cl)cc5)c(F)c1 | OpenEye OEToolkits 2.0.6 | c1cc(ccc1c2nc3cc(c(cc3n2C(COc4ccc(cc4F)C(=O)O)C5CCCCC5)F)F)Cl | CACTVS 3.385 | OC(=O)c1ccc(OC[C@H](C2CCCCC2)n3c4cc(F)c(F)cc4nc3c5ccc(Cl)cc5)c(F)c1 | OpenEye OEToolkits 2.0.6 | c1cc(ccc1c2nc3cc(c(cc3n2[C@H](COc4ccc(cc4F)C(=O)O)C5CCCCC5)F)F)Cl |
|
Formula | C28 H24 Cl F3 N2 O3 |
Name | 4-{(2S)-2-[2-(4-chlorophenyl)-5,6-difluoro-1H-benzimidazol-1-yl]-2-cyclohexylethoxy}-3-fluorobenzoic acid |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 5q14 Chain C Residue 501
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|