Structure of PDB 5q0v Chain C Binding Site BS02 |
|
|
Ligand ID | 9LS |
InChI | InChI=1S/C27H23ClF3N3O/c28-18-12-10-17(11-13-18)26-32-23-14-20(30)21(31)15-24(23)34(26)25(16-6-2-1-3-7-16)27(35)33-22-9-5-4-8-19(22)29/h4-5,8-16,25H,1-3,6-7H2,(H,33,35)/t25-/m0/s1 |
InChIKey | JBLFHKBJHMUDCM-VWLOTQADSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.6 | c1ccc(c(c1)NC(=O)[C@H](C2CCCCC2)n3c4cc(c(cc4nc3c5ccc(cc5)Cl)F)F)F | ACDLabs 12.01 | n3(C(C(=O)Nc1c(cccc1)F)C2CCCCC2)c5cc(c(cc5nc3c4ccc(cc4)Cl)F)F | OpenEye OEToolkits 2.0.6 | c1ccc(c(c1)NC(=O)C(C2CCCCC2)n3c4cc(c(cc4nc3c5ccc(cc5)Cl)F)F)F | CACTVS 3.385 | Fc1cc2nc(n([CH](C3CCCCC3)C(=O)Nc4ccccc4F)c2cc1F)c5ccc(Cl)cc5 | CACTVS 3.385 | Fc1cc2nc(n([C@@H](C3CCCCC3)C(=O)Nc4ccccc4F)c2cc1F)c5ccc(Cl)cc5 |
|
Formula | C27 H23 Cl F3 N3 O |
Name | (2S)-2-[2-(4-chlorophenyl)-5,6-difluoro-1H-benzimidazol-1-yl]-2-cyclohexyl-N-(2-fluorophenyl)acetamide |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 5q0v Chain C Residue 501
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|