Structure of PDB 5oxs Chain C Binding Site BS02 |
|
|
Ligand ID | GMH |
InChI | InChI=1S/C7H14O7/c8-1-2(9)6-4(11)3(10)5(12)7(13)14-6/h2-13H,1H2/t2-,3-,4-,5-,6+,7-/m0/s1 |
InChIKey | BGWQRWREUZVRGI-QQABCQGCSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.341 | OC[C@H](O)[C@H]1O[C@H](O)[C@@H](O)[C@@H](O)[C@@H]1O | OpenEye OEToolkits 1.5.0 | C(C(C1C(C(C(C(O1)O)O)O)O)O)O | CACTVS 3.341 | OC[CH](O)[CH]1O[CH](O)[CH](O)[CH](O)[CH]1O | ACDLabs 10.04 | OC1C(O)C(OC(O)C1O)C(O)CO | OpenEye OEToolkits 1.5.0 | C([C@@H]([C@@H]1[C@H]([C@@H]([C@@H]([C@H](O1)O)O)O)O)O)O |
|
Formula | C7 H14 O7 |
Name | L-glycero-alpha-D-manno-heptopyranose; L-glycero-alpha-D-manno-heptose; L-glycero-D-manno-heptose; L-glycero-manno-heptose; L-GLYCERO-D-MANNO-HEPTOPYRANOSE |
ChEMBL | |
DrugBank | DB04526 |
ZINC |
|
PDB chain | 5oxs Chain F Residue 2
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|