Structure of PDB 5ixs Chain C Binding Site BS02 |
|
|
Ligand ID | 6EY |
InChI | InChI=1S/C21H16ClNO3S2/c22-16-6-1-2-7-18(16)28-19-17(25)11-21(23-20(19)26,14-8-9-27-12-14)13-4-3-5-15(24)10-13/h1-10,12,24-25H,11H2,(H,23,26)/t21-/m1/s1 |
InChIKey | OMRJWBOJLQCFAO-OAQYLSRUSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | OC1=C(Sc2ccccc2Cl)C(=O)N[C](C1)(c3cscc3)c4cccc(O)c4 | OpenEye OEToolkits 2.0.4 | c1ccc(c(c1)SC2=C(CC(NC2=O)(c3cccc(c3)O)c4ccsc4)O)Cl | CACTVS 3.385 | OC1=C(Sc2ccccc2Cl)C(=O)N[C@@](C1)(c3cscc3)c4cccc(O)c4 | OpenEye OEToolkits 2.0.4 | c1ccc(c(c1)SC2=C(C[C@@](NC2=O)(c3cccc(c3)O)c4ccsc4)O)Cl | ACDLabs 12.01 | C=1(C(=O)NC(CC=1O)(c2cccc(O)c2)c3ccsc3)Sc4ccccc4Cl |
|
Formula | C21 H16 Cl N O3 S2 |
Name | (6R)-3-[(2-chlorophenyl)sulfanyl]-4-hydroxy-6-(3-hydroxyphenyl)-6-(thiophen-3-yl)-5,6-dihydropyridin-2(1H)-one |
ChEMBL | |
DrugBank | |
ZINC | ZINC000584904760
|
PDB chain | 5ixs Chain C Residue 403
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Catalytic site (original residue number in PDB) |
D165 R168 H192 |
Catalytic site (residue number reindexed from 1) |
D158 R161 H185 |
Enzyme Commision number |
1.1.1.27: L-lactate dehydrogenase. |
|
|
|